About [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol
[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol (PubChem CID 86691877) has the molecular formula C8H7F5N4OS
and a molecular weight of 302.23 g/mol. Its IUPAC name is [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol.
Molecular Properties
| Compound Name | [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol |
| PubChem CID | 86691877 |
| Molecular Formula | C8H7F5N4OS |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol |
| SMILES | OCc1nnnn1-c1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C8H7F5N4OS/c9-19(10,11,12,13)7-3-1-6(2-4-7)17-8(5-18)14-15-16-17/h1-4,18H,5H2 |
| InChIKey | QMHMGPUDKWOKHC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol?
The IUPAC name of [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol (CID 86691877) is [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol.
What is the SMILES notation for [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol?
The canonical SMILES for [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol is OCc1nnnn1-c1ccc(S(F)(F)(F)(F)F)cc1.
What is the InChIKey of [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol?
The InChIKey is QMHMGPUDKWOKHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F5N4OS/c9-19(10,11,12,13)7-3-1-6(2-4-7)17-8(5-18)14-15-16-17/h1-4,18H,5H2.
What are the key properties of [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol?
[1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol has a molecular weight of 302.23 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(pentafluoro-λ6-sulfanyl)phenyl]tetrazol-5-yl]methanol is sourced from PubChem (CID 86691877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).