C26H29F5N5O4S- — CID 86692131
N-tert-butyl-N-[(1R,2R)-2-[[5-ethyl-4-[6-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a]pyrimidin-3-yl]thiophene-2-carbonyl]amino]-3,3-difluorocyclohexyl]carbamate (PubChem CID 86692131) has the molecular formula C26H29F5N5O4S- and a molecular weight of 602.61 g/mol. Its IUPAC name is N-tert-butyl-N-[(1R,2R)-2-[[5-ethyl-4-[6-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a]pyrimidin-3-yl]thiophene-2-carbonyl]amino]-3,3-difluorocyclohexyl]carbamate.
| Compound Name | N-tert-butyl-N-[(1R,2R)-2-[[5-ethyl-4-[6-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a]pyrimidin-3-yl]thiophene-2-carbonyl]amino]-3,3-difluorocyclohexyl]carbamate |
|---|---|
| PubChem CID | 86692131 |
| Molecular Formula | C26H29F5N5O4S- |
| Molecular Weight | 602.61 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | N-tert-butyl-N-[(1R,2R)-2-[[5-ethyl-4-[6-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a]pyrimidin-3-yl]thiophene-2-carbonyl]amino]-3,3-difluorocyclohexyl]carbamate |
| SMILES | CCc1sc(C(=O)N[C@@H]2[C@H](N(C(=O)[O-])C(C)(C)C)CCCC2(F)F)cc1-c1cnn2cc(OCC(F)(F)F)cnc12 |
| InChI | InChI=1S/C26H30F5N5O4S/c1-5-18-15(16-11-33-35-12-14(10-32-21(16)35)40-13-26(29,30)31)9-19(41-18)22(37)34-20-17(7-6-8-25(20,27)28)36(23(38)39)24(2,3)4/h9-12,17,20H,5-8,13H2,1-4H3,(H,34,37)(H,38,39)/p-1/t17-,20-/m1/s1 |
| InChIKey | WNGAYVRVWJIPTL-YLJYHZDGSA-M |
| XLogP | 4.69 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |