C16H18N8O2 — CID 86692155
6-N-methyl-3-nitro-6-N-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]pyridine-2,6-diamine (PubChem CID 86692155) has the molecular formula C16H18N8O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 6-N-methyl-3-nitro-6-N-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]pyridine-2,6-diamine.
| Compound Name | 6-N-methyl-3-nitro-6-N-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 86692155 |
| Molecular Formula | C16H18N8O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 6-N-methyl-3-nitro-6-N-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]pyridine-2,6-diamine |
| SMILES | CN(c1ccc([N+](=O)[O-])c(N)n1)[C@@H]1CCN(c2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C16H18N8O2/c1-22(13-3-2-12(24(25)26)14(17)21-13)10-5-7-23(8-10)16-11-4-6-18-15(11)19-9-20-16/h2-4,6,9-10H,5,7-8H2,1H3,(H2,17,21)(H,18,19,20)/t10-/m1/s1 |
| InChIKey | JZOMKMSKYIANGF-SNVBAGLBSA-N |
| XLogP | 1.56 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|