C19H24FN7O — CID 86692691
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-6-N-(2-methoxyethyl)-4-N-[(3R)-piperidin-3-yl]pyrimidine-4,6-diamine (PubChem CID 86692691) has the molecular formula C19H24FN7O and a molecular weight of 385.45 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-6-N-(2-methoxyethyl)-4-N-[(3R)-piperidin-3-yl]pyrimidine-4,6-diamine.
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-6-N-(2-methoxyethyl)-4-N-[(3R)-piperidin-3-yl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 86692691 |
| Molecular Formula | C19H24FN7O |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-6-N-(2-methoxyethyl)-4-N-[(3R)-piperidin-3-yl]pyrimidine-4,6-diamine |
| SMILES | COCCNc1cc(N[C@@H]2CCCNC2)nc(-c2cnc3ccc(F)cn23)n1 |
| InChI | InChI=1S/C19H24FN7O/c1-28-8-7-22-16-9-17(24-14-3-2-6-21-10-14)26-19(25-16)15-11-23-18-5-4-13(20)12-27(15)18/h4-5,9,11-12,14,21H,2-3,6-8,10H2,1H3,(H2,22,24,25,26)/t14-/m1/s1 |
| InChIKey | AGGJSEGLHUDKAN-CQSZACIVSA-N |
| XLogP | 2.15 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|