C17H28N2O5S — CID 86692718
tert-butyl N-[6-(4-sulfamoylphenoxy)hexyl]carbamate (PubChem CID 86692718) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is tert-butyl N-[6-(4-sulfamoylphenoxy)hexyl]carbamate.
| Compound Name | tert-butyl N-[6-(4-sulfamoylphenoxy)hexyl]carbamate |
|---|---|
| PubChem CID | 86692718 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | tert-butyl N-[6-(4-sulfamoylphenoxy)hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCOc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H28N2O5S/c1-17(2,3)24-16(20)19-12-6-4-5-7-13-23-14-8-10-15(11-9-14)25(18,21)22/h8-11H,4-7,12-13H2,1-3H3,(H,19,20)(H2,18,21,22) |
| InChIKey | BRGLSNPXZWXVDY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|