About lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate
lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate (PubChem CID 86692769) has the molecular formula C11H16F3LiN2O2
and a molecular weight of 272.20 g/mol. Its IUPAC name is lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate.
Molecular Properties
| Compound Name | lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate |
| PubChem CID | 86692769 |
| Molecular Formula | C11H16F3LiN2O2 |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate |
| SMILES | O=C([O-])C1CCN1C1CCN(CC(F)(F)F)CC1.[Li+] |
| InChI | InChI=1S/C11H17F3N2O2.Li/c12-11(13,14)7-15-4-1-8(2-5-15)16-6-3-9(16)10(17)18;/h8-9H,1-7H2,(H,17,18);/q;+1/p-1 |
| InChIKey | YJTINPIMLPYIIO-UHFFFAOYSA-M |
| XLogP | -3.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate?
The IUPAC name of lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate (CID 86692769) is lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate.
What is the SMILES notation for lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate?
The canonical SMILES for lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate is O=C([O-])C1CCN1C1CCN(CC(F)(F)F)CC1.[Li+].
What is the InChIKey of lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate?
The InChIKey is YJTINPIMLPYIIO-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H17F3N2O2.Li/c12-11(13,14)7-15-4-1-8(2-5-15)16-6-3-9(16)10(17)18;/h8-9H,1-7H2,(H,17,18);/q;+1/p-1.
What are the key properties of lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate?
lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate has a molecular weight of 272.20 g/mol, XLogP of -3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]azetidine-2-carboxylate is sourced from PubChem (CID 86692769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).