About N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine
N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine (PubChem CID 86693640) has the molecular formula C21H26N4O
and a molecular weight of 350.47 g/mol. Its IUPAC name is N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine.
Molecular Properties
| Compound Name | N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine |
| PubChem CID | 86693640 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine |
| SMILES | CCc1cc(C2CCOCC2)ccc1N(C)c1cc2c(cn1)ncn2C |
| InChI | InChI=1S/C21H26N4O/c1-4-15-11-17(16-7-9-26-10-8-16)5-6-19(15)25(3)21-12-20-18(13-22-21)23-14-24(20)2/h5-6,11-14,16H,4,7-10H2,1-3H3 |
| InChIKey | MLWHHOOZWXIHTD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine?
The IUPAC name of N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine (CID 86693640) is N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine.
What is the SMILES notation for N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine?
The canonical SMILES for N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine is CCc1cc(C2CCOCC2)ccc1N(C)c1cc2c(cn1)ncn2C.
What is the InChIKey of N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine?
The InChIKey is MLWHHOOZWXIHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O/c1-4-15-11-17(16-7-9-26-10-8-16)5-6-19(15)25(3)21-12-20-18(13-22-21)23-14-24(20)2/h5-6,11-14,16H,4,7-10H2,1-3H3.
What are the key properties of N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine?
N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine has a molecular weight of 350.47 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-ethyl-4-(oxan-4-yl)phenyl]-N,1-dimethylimidazo[4,5-c]pyridin-6-amine is sourced from PubChem (CID 86693640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).