C39H42F3N3O4S — CID 86693893
benzyl (3R,4R)-3-[[[(1R)-1-[5-benzyl-2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2,2-dimethylpropyl]-[(2S)-oxolane-2-carbonyl]amino]methyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 86693893) has the molecular formula C39H42F3N3O4S and a molecular weight of 705.84 g/mol. Its IUPAC name is benzyl (3R,4R)-3-[[[(1R)-1-[5-benzyl-2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2,2-dimethylpropyl]-[(2S)-oxolane-2-carbonyl]amino]methyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R,4R)-3-[[[(1R)-1-[5-benzyl-2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2,2-dimethylpropyl]-[(2S)-oxolane-2-carbonyl]amino]methyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86693893 |
| Molecular Formula | C39H42F3N3O4S |
| Molecular Weight | 705.84 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | benzyl (3R,4R)-3-[[[(1R)-1-[5-benzyl-2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2,2-dimethylpropyl]-[(2S)-oxolane-2-carbonyl]amino]methyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[C@H](c1nc(-c2cc(F)ccc2F)sc1Cc1ccccc1)N(C[C@@H]1CN(C(=O)OCc2ccccc2)C[C@@H]1F)C(=O)[C@@H]1CCCO1 |
| InChI | InChI=1S/C39H42F3N3O4S/c1-39(2,3)35(34-33(19-25-11-6-4-7-12-25)50-36(43-34)29-20-28(40)16-17-30(29)41)45(37(46)32-15-10-18-48-32)22-27-21-44(23-31(27)42)38(47)49-24-26-13-8-5-9-14-26/h4-9,11-14,16-17,20,27,31-32,35H,10,15,18-19,21-24H2,1-3H3/t27-,31-,32-,35-/m0/s1 |
| InChIKey | GCJWTONCPJSNGR-CRIACTDMSA-N |
| XLogP | 8.38 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.84 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |