C17H19F3O4S2 — CID 86693898
methanesulfonate;1-[4-(2,2,2-trifluoroethoxy)naphthalen-1-yl]thiolan-1-ium (PubChem CID 86693898) has the molecular formula C17H19F3O4S2 and a molecular weight of 408.46 g/mol. Its IUPAC name is methanesulfonate;1-[4-(2,2,2-trifluoroethoxy)naphthalen-1-yl]thiolan-1-ium.
| Compound Name | methanesulfonate;1-[4-(2,2,2-trifluoroethoxy)naphthalen-1-yl]thiolan-1-ium |
|---|---|
| PubChem CID | 86693898 |
| Molecular Formula | C17H19F3O4S2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | methanesulfonate;1-[4-(2,2,2-trifluoroethoxy)naphthalen-1-yl]thiolan-1-ium |
| SMILES | CS(=O)(=O)[O-].FC(F)(F)COc1ccc([S+]2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C16H16F3OS.CH4O3S/c17-16(18,19)11-20-14-7-8-15(21-9-3-4-10-21)13-6-2-1-5-12(13)14;1-5(2,3)4/h1-2,5-8H,3-4,9-11H2;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | MNHGYQWVQUMEQY-UHFFFAOYSA-M |
| XLogP | 3.71 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|