C12H17N5O4 — CID 86693978
(2S,5R)-6-hydroxy-N-[(3-methylimidazol-4-yl)methoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 86693978) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-N-[(3-methylimidazol-4-yl)methoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (2S,5R)-6-hydroxy-N-[(3-methylimidazol-4-yl)methoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 86693978 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2S,5R)-6-hydroxy-N-[(3-methylimidazol-4-yl)methoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | Cn1cncc1CONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C12H17N5O4/c1-15-7-13-4-9(15)6-21-14-11(18)10-3-2-8-5-16(10)12(19)17(8)20/h4,7-8,10,20H,2-3,5-6H2,1H3,(H,14,18)/t8-,10+/m1/s1 |
| InChIKey | YNTHXZYBOCGYED-SCZZXKLOSA-N |
| XLogP | -0.37 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|