C16H23N5O6 — CID 86693989
tert-butyl 4-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]imidazole-1-carboxylate (PubChem CID 86693989) has the molecular formula C16H23N5O6 and a molecular weight of 381.39 g/mol. Its IUPAC name is tert-butyl 4-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]imidazole-1-carboxylate.
| Compound Name | tert-butyl 4-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 86693989 |
| Molecular Formula | C16H23N5O6 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | tert-butyl 4-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]imidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc(CONC(=O)[C@@H]2CC[C@@H]3CN2C(=O)N3O)c1 |
| InChI | InChI=1S/C16H23N5O6/c1-16(2,3)27-15(24)19-6-10(17-9-19)8-26-18-13(22)12-5-4-11-7-20(12)14(23)21(11)25/h6,9,11-12,25H,4-5,7-8H2,1-3H3,(H,18,22)/t11-,12+/m1/s1 |
| InChIKey | OGPPBZALYAVPJX-NEPJUHHUSA-N |
| XLogP | 0.87 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|