About 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one
7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one (PubChem CID 86694149) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one.
Molecular Properties
| Compound Name | 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one |
| PubChem CID | 86694149 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one |
| SMILES | CC1(C)C(=O)N(C2CCNCC2)c2nccnc21 |
| InChI | InChI=1S/C13H18N4O/c1-13(2)10-11(16-8-7-15-10)17(12(13)18)9-3-5-14-6-4-9/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | MHEZURSTBVGRDF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one?
The IUPAC name of 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one (CID 86694149) is 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one.
What is the SMILES notation for 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one?
The canonical SMILES for 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one is CC1(C)C(=O)N(C2CCNCC2)c2nccnc21.
What is the InChIKey of 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one?
The InChIKey is MHEZURSTBVGRDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O/c1-13(2)10-11(16-8-7-15-10)17(12(13)18)9-3-5-14-6-4-9/h7-9,14H,3-6H2,1-2H3.
What are the key properties of 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one?
7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one has a molecular weight of 246.31 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-5-piperidin-4-ylpyrrolo[2,3-b]pyrazin-6-one is sourced from PubChem (CID 86694149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).