About 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride
3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride (PubChem CID 86694219) has the molecular formula C11H16Cl2N4O
and a molecular weight of 291.18 g/mol. Its IUPAC name is 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride |
| PubChem CID | 86694219 |
| Molecular Formula | C11H16Cl2N4O |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride |
| SMILES | Cl.Cl.Cn1c(=O)n(C2CC(N)C2)c2ncccc21 |
| InChI | InChI=1S/C11H14N4O.2ClH/c1-14-9-3-2-4-13-10(9)15(11(14)16)8-5-7(12)6-8;;/h2-4,7-8H,5-6,12H2,1H3;2*1H |
| InChIKey | HPWYDQWRXRPZSI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride?
The IUPAC name of 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride (CID 86694219) is 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride.
What is the SMILES notation for 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride?
The canonical SMILES for 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride is Cl.Cl.Cn1c(=O)n(C2CC(N)C2)c2ncccc21.
What is the InChIKey of 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride?
The InChIKey is HPWYDQWRXRPZSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O.2ClH/c1-14-9-3-2-4-13-10(9)15(11(14)16)8-5-7(12)6-8;;/h2-4,7-8H,5-6,12H2,1H3;2*1H.
What are the key properties of 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride?
3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride has a molecular weight of 291.18 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminocyclobutyl)-1-methylimidazo[4,5-b]pyridin-2-one;dihydrochloride is sourced from PubChem (CID 86694219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).