C23H25N5O4 — CID 86694433
(4-methoxycarbonylphenyl)methyl (3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate (PubChem CID 86694433) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl)methyl (3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl)methyl (3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 86694433 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (4-methoxycarbonylphenyl)methyl (3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)N2CCC[C@@H]3[C@H]2CCN3c2ncnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C23H25N5O4/c1-31-22(29)16-6-4-15(5-7-16)13-32-23(30)28-11-2-3-18-19(28)9-12-27(18)21-17-8-10-24-20(17)25-14-26-21/h4-8,10,14,18-19H,2-3,9,11-13H2,1H3,(H,24,25,26)/t18-,19-/m1/s1 |
| InChIKey | UIIUTLYRQKDIQE-RTBURBONSA-N |
| XLogP | 3.12 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |