About methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate
methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate (PubChem CID 86694914) has the molecular formula C17H18Cl2N2O4
and a molecular weight of 385.25 g/mol. Its IUPAC name is methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate |
| PubChem CID | 86694914 |
| Molecular Formula | C17H18Cl2N2O4 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)Cn1c(=O)cc(Cl)n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C17H18Cl2N2O4/c1-17(2,15(23)25-3)10-21-14(22)8-13(19)20(16(21)24)9-11-4-6-12(18)7-5-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | YJQJGTSWJSGMMJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate?
The IUPAC name of methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate (CID 86694914) is methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate.
What is the SMILES notation for methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate?
The canonical SMILES for methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate is COC(=O)C(C)(C)Cn1c(=O)cc(Cl)n(Cc2ccc(Cl)cc2)c1=O.
What is the InChIKey of methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate?
The InChIKey is YJQJGTSWJSGMMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N2O4/c1-17(2,15(23)25-3)10-21-14(22)8-13(19)20(16(21)24)9-11-4-6-12(18)7-5-11/h4-8H,9-10H2,1-3H3.
What are the key properties of methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate?
methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate has a molecular weight of 385.25 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-chloro-3-[(4-chlorophenyl)methyl]-2,6-dioxopyrimidin-1-yl]-2,2-dimethylpropanoate is sourced from PubChem (CID 86694914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).