About methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate
methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate (PubChem CID 86694966) has the molecular formula C26H19F3O2S
and a molecular weight of 452.50 g/mol. Its IUPAC name is methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate |
| PubChem CID | 86694966 |
| Molecular Formula | C26H19F3O2S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate |
| SMILES | COC(=O)Cc1cc2ccc(F)cc2c(-c2ccc(Sc3ccc(F)cc3F)cc2)c1C |
| InChI | InChI=1S/C26H19F3O2S/c1-15-18(12-25(30)31-2)11-17-3-6-19(27)13-22(17)26(15)16-4-8-21(9-5-16)32-24-10-7-20(28)14-23(24)29/h3-11,13-14H,12H2,1-2H3 |
| InChIKey | KGRUEJRKJIFQKZ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate?
The IUPAC name of methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate (CID 86694966) is methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate.
What is the SMILES notation for methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate?
The canonical SMILES for methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate is COC(=O)Cc1cc2ccc(F)cc2c(-c2ccc(Sc3ccc(F)cc3F)cc2)c1C.
What is the InChIKey of methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate?
The InChIKey is KGRUEJRKJIFQKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19F3O2S/c1-15-18(12-25(30)31-2)11-17-3-6-19(27)13-22(17)26(15)16-4-8-21(9-5-16)32-24-10-7-20(28)14-23(24)29/h3-11,13-14H,12H2,1-2H3.
What are the key properties of methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate?
methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate has a molecular weight of 452.50 g/mol, XLogP of 7.10, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-[4-(2,4-difluorophenyl)sulfanylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate is sourced from PubChem (CID 86694966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).