C24H26FNO4S — CID 86695020
methyl 2-[4-[4-(diethylsulfamoyl)phenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate (PubChem CID 86695020) has the molecular formula C24H26FNO4S and a molecular weight of 443.54 g/mol. Its IUPAC name is methyl 2-[4-[4-(diethylsulfamoyl)phenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate.
| Compound Name | methyl 2-[4-[4-(diethylsulfamoyl)phenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 86695020 |
| Molecular Formula | C24H26FNO4S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | methyl 2-[4-[4-(diethylsulfamoyl)phenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2c(C)c(CC(=O)OC)cc3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C24H26FNO4S/c1-5-26(6-2)31(28,29)21-11-8-17(9-12-21)24-16(3)19(14-23(27)30-4)13-18-7-10-20(25)15-22(18)24/h7-13,15H,5-6,14H2,1-4H3 |
| InChIKey | XEWKNSPCFKZABX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |