C38H37BrN6O2 — CID 86695578
tert-butyl (3R)-3-[3-(3-bromo-1-tritylindazol-5-yl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate (PubChem CID 86695578) has the molecular formula C38H37BrN6O2 and a molecular weight of 689.66 g/mol. Its IUPAC name is tert-butyl (3R)-3-[3-(3-bromo-1-tritylindazol-5-yl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[3-(3-bromo-1-tritylindazol-5-yl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86695578 |
| Molecular Formula | C38H37BrN6O2 |
| Molecular Weight | 689.66 g/mol |
| Exact Mass | 688.22 |
| IUPAC Name | tert-butyl (3R)-3-[3-(3-bromo-1-tritylindazol-5-yl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](c2nc(-c3ccc4c(c3)c(Br)nn4C(c3ccccc3)(c3ccccc3)c3ccccc3)n[nH]2)C1 |
| InChI | InChI=1S/C38H37BrN6O2/c1-37(2,3)47-36(46)44-23-13-14-27(25-44)35-40-34(41-42-35)26-21-22-32-31(24-26)33(39)43-45(32)38(28-15-7-4-8-16-28,29-17-9-5-10-18-29)30-19-11-6-12-20-30/h4-12,15-22,24,27H,13-14,23,25H2,1-3H3,(H,40,41,42)/t27-/m1/s1 |
| InChIKey | COLXDYRHGUXUCR-HHHXNRCGSA-N |
| XLogP | 8.54 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.66 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|