C43H41N7O2 — CID 86695579
tert-butyl (3R)-3-[3-(3-pyridin-4-yl-1-tritylindazol-5-yl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate (PubChem CID 86695579) has the molecular formula C43H41N7O2 and a molecular weight of 687.85 g/mol. Its IUPAC name is tert-butyl (3R)-3-[3-(3-pyridin-4-yl-1-tritylindazol-5-yl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[3-(3-pyridin-4-yl-1-tritylindazol-5-yl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86695579 |
| Molecular Formula | C43H41N7O2 |
| Molecular Weight | 687.85 g/mol |
| Exact Mass | 687.33 |
| IUPAC Name | tert-butyl (3R)-3-[3-(3-pyridin-4-yl-1-tritylindazol-5-yl)-1H-1,2,4-triazol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](c2nc(-c3ccc4c(c3)c(-c3ccncc3)nn4C(c3ccccc3)(c3ccccc3)c3ccccc3)n[nH]2)C1 |
| InChI | InChI=1S/C43H41N7O2/c1-42(2,3)52-41(51)49-27-13-14-32(29-49)40-45-39(46-47-40)31-21-22-37-36(28-31)38(30-23-25-44-26-24-30)48-50(37)43(33-15-7-4-8-16-33,34-17-9-5-10-18-34)35-19-11-6-12-20-35/h4-12,15-26,28,32H,13-14,27,29H2,1-3H3,(H,45,46,47)/t32-/m1/s1 |
| InChIKey | HSDQHELLFDGKNJ-JGCGQSQUSA-N |
| XLogP | 8.84 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.85 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|