About (5R)-5-(azidomethyl)-2,2-dimethyloxolane
(5R)-5-(azidomethyl)-2,2-dimethyloxolane (PubChem CID 86695688) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-2,2-dimethyloxolane.
Molecular Properties
| Compound Name | (5R)-5-(azidomethyl)-2,2-dimethyloxolane |
| PubChem CID | 86695688 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (5R)-5-(azidomethyl)-2,2-dimethyloxolane |
| SMILES | CC1(C)CC[C@H](CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C7H13N3O/c1-7(2)4-3-6(11-7)5-9-10-8/h6H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | KXZCFNXWFCMVOG-ZCFIWIBFSA-N |
| XLogP | 2.25 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(azidomethyl)-2,2-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(azidomethyl)-2,2-dimethyloxolane?
The IUPAC name of (5R)-5-(azidomethyl)-2,2-dimethyloxolane (CID 86695688) is (5R)-5-(azidomethyl)-2,2-dimethyloxolane.
What is the SMILES notation for (5R)-5-(azidomethyl)-2,2-dimethyloxolane?
The canonical SMILES for (5R)-5-(azidomethyl)-2,2-dimethyloxolane is CC1(C)CC[C@H](CN=[N+]=[N-])O1.
What is the InChIKey of (5R)-5-(azidomethyl)-2,2-dimethyloxolane?
The InChIKey is KXZCFNXWFCMVOG-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H13N3O/c1-7(2)4-3-6(11-7)5-9-10-8/h6H,3-5H2,1-2H3/t6-/m1/s1.
What are the key properties of (5R)-5-(azidomethyl)-2,2-dimethyloxolane?
(5R)-5-(azidomethyl)-2,2-dimethyloxolane has a molecular weight of 155.20 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(azidomethyl)-2,2-dimethyloxolane is sourced from PubChem (CID 86695688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).