About tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate
tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate (PubChem CID 86695928) has the molecular formula C22H24F3NO2
and a molecular weight of 391.43 g/mol. Its IUPAC name is tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate.
Molecular Properties
| Compound Name | tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate |
| PubChem CID | 86695928 |
| Molecular Formula | C22H24F3NO2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate |
| SMILES | CC(C)(C)OC(=O)C(CCC(F)(F)F)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24F3NO2/c1-21(2,3)28-20(27)18(14-15-22(23,24)25)26-19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18H,14-15H2,1-3H3 |
| InChIKey | XVSQOLAOMZHRGM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate?
The IUPAC name of tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate (CID 86695928) is tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate.
What is the SMILES notation for tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate?
The canonical SMILES for tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate is CC(C)(C)OC(=O)C(CCC(F)(F)F)N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate?
The InChIKey is XVSQOLAOMZHRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24F3NO2/c1-21(2,3)28-20(27)18(14-15-22(23,24)25)26-19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18H,14-15H2,1-3H3.
What are the key properties of tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate?
tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate has a molecular weight of 391.43 g/mol, XLogP of 5.58, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(benzhydrylideneamino)-5,5,5-trifluoropentanoate is sourced from PubChem (CID 86695928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).