C22H18Cl2F3NO2S — CID 86695998
4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methyl-N-(3-methylthietan-3-yl)benzamide (PubChem CID 86695998) has the molecular formula C22H18Cl2F3NO2S and a molecular weight of 488.36 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methyl-N-(3-methylthietan-3-yl)benzamide.
| Compound Name | 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methyl-N-(3-methylthietan-3-yl)benzamide |
|---|---|
| PubChem CID | 86695998 |
| Molecular Formula | C22H18Cl2F3NO2S |
| Molecular Weight | 488.36 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methyl-N-(3-methylthietan-3-yl)benzamide |
| SMILES | Cc1cc(C(=O)/C=C(\c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1C(=O)NC1(C)CSC1 |
| InChI | InChI=1S/C22H18Cl2F3NO2S/c1-12-5-13(3-4-17(12)20(30)28-21(2)10-31-11-21)19(29)9-18(22(25,26)27)14-6-15(23)8-16(24)7-14/h3-9H,10-11H2,1-2H3,(H,28,30)/b18-9+ |
| InChIKey | CGSOTVQCJJHNJD-GIJQJNRQSA-N |
| XLogP | 6.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.36 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|