About 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one
3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one (PubChem CID 86696615) has the molecular formula C14H19BrN4O2
and a molecular weight of 355.24 g/mol. Its IUPAC name is 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one.
Molecular Properties
| Compound Name | 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one |
| PubChem CID | 86696615 |
| Molecular Formula | C14H19BrN4O2 |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one |
| SMILES | COC1CCC(CN2C(=O)CNc3ncc(Br)nc32)CC1 |
| InChI | InChI=1S/C14H19BrN4O2/c1-21-10-4-2-9(3-5-10)8-19-12(20)7-17-13-14(19)18-11(15)6-16-13/h6,9-10H,2-5,7-8H2,1H3,(H,16,17) |
| InChIKey | RBCIZFTUWNECGB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one?
The IUPAC name of 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one (CID 86696615) is 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one.
What is the SMILES notation for 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one?
The canonical SMILES for 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one is COC1CCC(CN2C(=O)CNc3ncc(Br)nc32)CC1.
What is the InChIKey of 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one?
The InChIKey is RBCIZFTUWNECGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrN4O2/c1-21-10-4-2-9(3-5-10)8-19-12(20)7-17-13-14(19)18-11(15)6-16-13/h6,9-10H,2-5,7-8H2,1H3,(H,16,17).
What are the key properties of 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one?
3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one has a molecular weight of 355.24 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-[(4-methoxycyclohexyl)methyl]-7,8-dihydropyrazino[2,3-b]pyrazin-6-one is sourced from PubChem (CID 86696615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).