About 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one
2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one (PubChem CID 86696639) has the molecular formula C15H16ClN5O3
and a molecular weight of 349.78 g/mol. Its IUPAC name is 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one.
Molecular Properties
| Compound Name | 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one |
| PubChem CID | 86696639 |
| Molecular Formula | C15H16ClN5O3 |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one |
| SMILES | COc1ccc(Cn2c(=O)n(C)c3c(Cl)nc(N)nc32)cc1OC |
| InChI | InChI=1S/C15H16ClN5O3/c1-20-11-12(16)18-14(17)19-13(11)21(15(20)22)7-8-4-5-9(23-2)10(6-8)24-3/h4-6H,7H2,1-3H3,(H2,17,18,19) |
| InChIKey | HJCDSTWXNKXCTG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one?
The IUPAC name of 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one (CID 86696639) is 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one.
What is the SMILES notation for 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one?
The canonical SMILES for 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one is COc1ccc(Cn2c(=O)n(C)c3c(Cl)nc(N)nc32)cc1OC.
What is the InChIKey of 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one?
The InChIKey is HJCDSTWXNKXCTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN5O3/c1-20-11-12(16)18-14(17)19-13(11)21(15(20)22)7-8-4-5-9(23-2)10(6-8)24-3/h4-6H,7H2,1-3H3,(H2,17,18,19).
What are the key properties of 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one?
2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one has a molecular weight of 349.78 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-chloro-9-[(3,4-dimethoxyphenyl)methyl]-7-methylpurin-8-one is sourced from PubChem (CID 86696639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).