C20H21N7O4 — CID 86696640
5-amino-3-[(3,4-dimethoxyphenyl)methyl]-8-(furan-2-yl)-1-methyl-3aH-purino[7,8-b][1,2,4]triazol-2-one (PubChem CID 86696640) has the molecular formula C20H21N7O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is 5-amino-3-[(3,4-dimethoxyphenyl)methyl]-8-(furan-2-yl)-1-methyl-3aH-purino[7,8-b][1,2,4]triazol-2-one.
| Compound Name | 5-amino-3-[(3,4-dimethoxyphenyl)methyl]-8-(furan-2-yl)-1-methyl-3aH-purino[7,8-b][1,2,4]triazol-2-one |
|---|---|
| PubChem CID | 86696640 |
| Molecular Formula | C20H21N7O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 5-amino-3-[(3,4-dimethoxyphenyl)methyl]-8-(furan-2-yl)-1-methyl-3aH-purino[7,8-b][1,2,4]triazol-2-one |
| SMILES | COc1ccc(CN2C(=O)N(C)N3C4=C(c5ccco5)N=CN(N)C4=NC23)cc1OC |
| InChI | InChI=1S/C20H21N7O4/c1-24-20(28)25(10-12-6-7-13(29-2)15(9-12)30-3)19-23-18-17(27(19)24)16(22-11-26(18)21)14-5-4-8-31-14/h4-9,11,19H,10,21H2,1-3H3 |
| InChIKey | BIYOUJPRFUQJNU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|