C8H14F5NOS — CID 86696809
N-methyl-3-(3,3,4,4,4-pentafluorobutylsulfinyl)propan-1-amine (PubChem CID 86696809) has the molecular formula C8H14F5NOS and a molecular weight of 267.26 g/mol. Its IUPAC name is N-methyl-3-(3,3,4,4,4-pentafluorobutylsulfinyl)propan-1-amine.
| Compound Name | N-methyl-3-(3,3,4,4,4-pentafluorobutylsulfinyl)propan-1-amine |
|---|---|
| PubChem CID | 86696809 |
| Molecular Formula | C8H14F5NOS |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-methyl-3-(3,3,4,4,4-pentafluorobutylsulfinyl)propan-1-amine |
| SMILES | CNCCCS(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H14F5NOS/c1-14-4-2-5-16(15)6-3-7(9,10)8(11,12)13/h14H,2-6H2,1H3 |
| InChIKey | SFKVQOOHIRBIEX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|