C12H22F5NO3S — CID 86696820
3-methoxy-N-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]propan-1-amine (PubChem CID 86696820) has the molecular formula C12H22F5NO3S and a molecular weight of 355.37 g/mol. Its IUPAC name is 3-methoxy-N-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]propan-1-amine.
| Compound Name | 3-methoxy-N-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]propan-1-amine |
|---|---|
| PubChem CID | 86696820 |
| Molecular Formula | C12H22F5NO3S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3-methoxy-N-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]propan-1-amine |
| SMILES | COCCCNCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H22F5NO3S/c1-21-8-3-6-18-7-4-10-22(19,20)9-2-5-11(13,14)12(15,16)17/h18H,2-10H2,1H3 |
| InChIKey | CKXAVPPEIYACLX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|