C10H17F6NO2S — CID 86696821
N-(2-fluoroethyl)-3-(4,4,5,5,5-pentafluoropentylsulfonyl)propan-1-amine (PubChem CID 86696821) has the molecular formula C10H17F6NO2S and a molecular weight of 329.31 g/mol. Its IUPAC name is N-(2-fluoroethyl)-3-(4,4,5,5,5-pentafluoropentylsulfonyl)propan-1-amine.
| Compound Name | N-(2-fluoroethyl)-3-(4,4,5,5,5-pentafluoropentylsulfonyl)propan-1-amine |
|---|---|
| PubChem CID | 86696821 |
| Molecular Formula | C10H17F6NO2S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-(2-fluoroethyl)-3-(4,4,5,5,5-pentafluoropentylsulfonyl)propan-1-amine |
| SMILES | O=S(=O)(CCCNCCF)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H17F6NO2S/c11-4-6-17-5-2-8-20(18,19)7-1-3-9(12,13)10(14,15)16/h17H,1-8H2 |
| InChIKey | WRIVOBZDONFVDS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|