C11H18F5NO2S — CID 86696822
N-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]cyclopropanamine (PubChem CID 86696822) has the molecular formula C11H18F5NO2S and a molecular weight of 323.33 g/mol. Its IUPAC name is N-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]cyclopropanamine.
| Compound Name | N-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 86696822 |
| Molecular Formula | C11H18F5NO2S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]cyclopropanamine |
| SMILES | O=S(=O)(CCCNC1CC1)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H18F5NO2S/c12-10(13,11(14,15)16)5-1-7-20(18,19)8-2-6-17-9-3-4-9/h9,17H,1-8H2 |
| InChIKey | PHNQVAXHURQWOB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|