C10H15F8NO2S — CID 86696826
3-(4,4,5,5,5-pentafluoropentylsulfonyl)-N-(2,2,2-trifluoroethyl)propan-1-amine (PubChem CID 86696826) has the molecular formula C10H15F8NO2S and a molecular weight of 365.29 g/mol. Its IUPAC name is 3-(4,4,5,5,5-pentafluoropentylsulfonyl)-N-(2,2,2-trifluoroethyl)propan-1-amine.
| Compound Name | 3-(4,4,5,5,5-pentafluoropentylsulfonyl)-N-(2,2,2-trifluoroethyl)propan-1-amine |
|---|---|
| PubChem CID | 86696826 |
| Molecular Formula | C10H15F8NO2S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 3-(4,4,5,5,5-pentafluoropentylsulfonyl)-N-(2,2,2-trifluoroethyl)propan-1-amine |
| SMILES | O=S(=O)(CCCNCC(F)(F)F)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F8NO2S/c11-8(12,10(16,17)18)3-1-5-22(20,21)6-2-4-19-7-9(13,14)15/h19H,1-7H2 |
| InChIKey | ZLRIWVAXSRUXOZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|