About (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol
(2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol (PubChem CID 86696837) has the molecular formula C11H22F3NO3S
and a molecular weight of 305.36 g/mol. Its IUPAC name is (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol |
| PubChem CID | 86696837 |
| Molecular Formula | C11H22F3NO3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol |
| SMILES | C[C@H](O)CNCCCCS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H22F3NO3S/c1-10(16)9-15-6-2-3-7-19(17,18)8-4-5-11(12,13)14/h10,15-16H,2-9H2,1H3/t10-/m0/s1 |
| InChIKey | XKIXSIVAPKQVPP-JTQLQIEISA-N |
| XLogP | 1.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol?
The IUPAC name of (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol (CID 86696837) is (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol.
What is the SMILES notation for (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol?
The canonical SMILES for (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol is C[C@H](O)CNCCCCS(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol?
The InChIKey is XKIXSIVAPKQVPP-JTQLQIEISA-N. The full InChI is InChI=1S/C11H22F3NO3S/c1-10(16)9-15-6-2-3-7-19(17,18)8-4-5-11(12,13)14/h10,15-16H,2-9H2,1H3/t10-/m0/s1.
What are the key properties of (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol?
(2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol has a molecular weight of 305.36 g/mol, XLogP of 1.49, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[4-(4,4,4-trifluorobutylsulfonyl)butylamino]propan-2-ol is sourced from PubChem (CID 86696837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).