C10H18F5NOS — CID 86696857
N-methyl-4-(4,4,5,5,5-pentafluoropentylsulfinyl)butan-1-amine (PubChem CID 86696857) has the molecular formula C10H18F5NOS and a molecular weight of 295.32 g/mol. Its IUPAC name is N-methyl-4-(4,4,5,5,5-pentafluoropentylsulfinyl)butan-1-amine.
| Compound Name | N-methyl-4-(4,4,5,5,5-pentafluoropentylsulfinyl)butan-1-amine |
|---|---|
| PubChem CID | 86696857 |
| Molecular Formula | C10H18F5NOS |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-methyl-4-(4,4,5,5,5-pentafluoropentylsulfinyl)butan-1-amine |
| SMILES | CNCCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H18F5NOS/c1-16-6-2-3-7-18(17)8-4-5-9(11,12)10(13,14)15/h16H,2-8H2,1H3 |
| InChIKey | TZFZDOPUYHOQEM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|