C10H18F5NO3S — CID 86696865
2-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]ethanol (PubChem CID 86696865) has the molecular formula C10H18F5NO3S and a molecular weight of 327.32 g/mol. Its IUPAC name is 2-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]ethanol.
| Compound Name | 2-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]ethanol |
|---|---|
| PubChem CID | 86696865 |
| Molecular Formula | C10H18F5NO3S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]ethanol |
| SMILES | O=S(=O)(CCCNCCO)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H18F5NO3S/c11-9(12,10(13,14)15)3-1-7-20(18,19)8-2-4-16-5-6-17/h16-17H,1-8H2 |
| InChIKey | YOMOCRDPQHEKFH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|