About 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine
6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine (PubChem CID 86697012) has the molecular formula C9H9BrN4
and a molecular weight of 253.10 g/mol. Its IUPAC name is 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine |
| PubChem CID | 86697012 |
| Molecular Formula | C9H9BrN4 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1ncc2cc(Br)c(C)nc2n1 |
| InChI | InChI=1S/C9H9BrN4/c1-5-7(10)3-6-4-12-9(11-2)14-8(6)13-5/h3-4H,1-2H3,(H,11,12,13,14) |
| InChIKey | VXIPPNFZDKMJAD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine?
The IUPAC name of 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine (CID 86697012) is 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine is CNc1ncc2cc(Br)c(C)nc2n1.
What is the InChIKey of 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine?
The InChIKey is VXIPPNFZDKMJAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN4/c1-5-7(10)3-6-4-12-9(11-2)14-8(6)13-5/h3-4H,1-2H3,(H,11,12,13,14).
What are the key properties of 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine?
6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine has a molecular weight of 253.10 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N,7-dimethylpyrido[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 86697012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).