About 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine
4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine (PubChem CID 86697074) has the molecular formula C13H8BrCl2N3
and a molecular weight of 357.04 g/mol. Its IUPAC name is 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine |
| PubChem CID | 86697074 |
| Molecular Formula | C13H8BrCl2N3 |
| Molecular Weight | 357.04 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine |
| SMILES | Cc1cnc(Br)c2cn(-c3c(Cl)cccc3Cl)nc12 |
| InChI | InChI=1S/C13H8BrCl2N3/c1-7-5-17-13(14)8-6-19(18-11(7)8)12-9(15)3-2-4-10(12)16/h2-6H,1H3 |
| InChIKey | USKUDONJMAKYBF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.04 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine?
The IUPAC name of 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine (CID 86697074) is 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine.
What is the SMILES notation for 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine?
The canonical SMILES for 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine is Cc1cnc(Br)c2cn(-c3c(Cl)cccc3Cl)nc12.
What is the InChIKey of 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine?
The InChIKey is USKUDONJMAKYBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrCl2N3/c1-7-5-17-13(14)8-6-19(18-11(7)8)12-9(15)3-2-4-10(12)16/h2-6H,1H3.
What are the key properties of 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine?
4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine has a molecular weight of 357.04 g/mol, XLogP of 4.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(2,6-dichlorophenyl)-7-methylpyrazolo[4,3-c]pyridine is sourced from PubChem (CID 86697074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).