About 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol
3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol (PubChem CID 86697223) has the molecular formula C14H19BrO2
and a molecular weight of 299.21 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol.
Molecular Properties
| Compound Name | 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol |
| PubChem CID | 86697223 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol |
| SMILES | Cc1cc(OC2CCC(C)(O)C2)cc(C)c1Br |
| InChI | InChI=1S/C14H19BrO2/c1-9-6-12(7-10(2)13(9)15)17-11-4-5-14(3,16)8-11/h6-7,11,16H,4-5,8H2,1-3H3 |
| InChIKey | ZNSPJBHNUFILRD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol?
The IUPAC name of 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol (CID 86697223) is 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol.
What is the SMILES notation for 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol?
The canonical SMILES for 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol is Cc1cc(OC2CCC(C)(O)C2)cc(C)c1Br.
What is the InChIKey of 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol?
The InChIKey is ZNSPJBHNUFILRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrO2/c1-9-6-12(7-10(2)13(9)15)17-11-4-5-14(3,16)8-11/h6-7,11,16H,4-5,8H2,1-3H3.
What are the key properties of 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol?
3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol has a molecular weight of 299.21 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-3,5-dimethylphenoxy)-1-methylcyclopentan-1-ol is sourced from PubChem (CID 86697223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).