About 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one
6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one (PubChem CID 86697561) has the molecular formula C7H6ClN3O
and a molecular weight of 183.60 g/mol. Its IUPAC name is 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 86697561 |
| Molecular Formula | C7H6ClN3O |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one |
| SMILES | O=C1CNc2ccc(Cl)nc2N1 |
| InChI | InChI=1S/C7H6ClN3O/c8-5-2-1-4-7(10-5)11-6(12)3-9-4/h1-2,9H,3H2,(H,10,11,12) |
| InChIKey | KMJARQBZUOZMQM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one (CID 86697561) is 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one is O=C1CNc2ccc(Cl)nc2N1.
What is the InChIKey of 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one?
The InChIKey is KMJARQBZUOZMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O/c8-5-2-1-4-7(10-5)11-6(12)3-9-4/h1-2,9H,3H2,(H,10,11,12).
What are the key properties of 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one?
6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one has a molecular weight of 183.60 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,4-dihydro-1H-pyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 86697561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).