C26H26F3N8O5P-2 — CID 86697706
6-[1-(4-hydroxybutyl)pyrazol-4-yl]-N-methyl-3-[[2-[4-(phosphonatomethyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]pyridine-2-carboxamide (PubChem CID 86697706) has the molecular formula C26H26F3N8O5P-2 and a molecular weight of 618.51 g/mol. Its IUPAC name is 6-[1-(4-hydroxybutyl)pyrazol-4-yl]-N-methyl-3-[[2-[4-(phosphonatomethyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]pyridine-2-carboxamide.
| Compound Name | 6-[1-(4-hydroxybutyl)pyrazol-4-yl]-N-methyl-3-[[2-[4-(phosphonatomethyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 86697706 |
| Molecular Formula | C26H26F3N8O5P-2 |
| Molecular Weight | 618.51 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | 6-[1-(4-hydroxybutyl)pyrazol-4-yl]-N-methyl-3-[[2-[4-(phosphonatomethyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1nc(-c2cnn(CCCCO)c2)ccc1Nc1nc(Nc2ccc(CP(=O)([O-])[O-])cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C26H28F3N8O5P/c1-30-24(39)22-21(9-8-20(34-22)17-12-32-37(14-17)10-2-3-11-38)35-23-19(26(27,28)29)13-31-25(36-23)33-18-6-4-16(5-7-18)15-43(40,41)42/h4-9,12-14,38H,2-3,10-11,15H2,1H3,(H,30,39)(H2,40,41,42)(H2,31,33,35,36)/p-2 |
| InChIKey | FSBBHLHPBAOTGY-UHFFFAOYSA-L |
| XLogP | 2.79 |
| TPSA | 193.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|