C21H22BrClN4O3S — CID 86699003
6-[2-bromoethyl(methylsulfonyl)amino]-2-(4-chlorophenyl)-5-cyclopropyl-N-methylindazole-3-carboxamide (PubChem CID 86699003) has the molecular formula C21H22BrClN4O3S and a molecular weight of 525.86 g/mol. Its IUPAC name is 6-[2-bromoethyl(methylsulfonyl)amino]-2-(4-chlorophenyl)-5-cyclopropyl-N-methylindazole-3-carboxamide.
| Compound Name | 6-[2-bromoethyl(methylsulfonyl)amino]-2-(4-chlorophenyl)-5-cyclopropyl-N-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 86699003 |
| Molecular Formula | C21H22BrClN4O3S |
| Molecular Weight | 525.86 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | 6-[2-bromoethyl(methylsulfonyl)amino]-2-(4-chlorophenyl)-5-cyclopropyl-N-methylindazole-3-carboxamide |
| SMILES | CNC(=O)c1c2cc(C3CC3)c(N(CCBr)S(C)(=O)=O)cc2nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22BrClN4O3S/c1-24-21(28)20-17-11-16(13-3-4-13)19(26(10-9-22)31(2,29)30)12-18(17)25-27(20)15-7-5-14(23)6-8-15/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,24,28) |
| InChIKey | JSXMIXMDDWPLHQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.86 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|