C27H27F3N2OSSi — CID 86699210
trimethyl-[2-[[5-[4-[4-(trifluoromethyl)phenyl]phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-3-yl]methoxy]ethyl]silane (PubChem CID 86699210) has the molecular formula C27H27F3N2OSSi and a molecular weight of 512.67 g/mol. Its IUPAC name is trimethyl-[2-[[5-[4-[4-(trifluoromethyl)phenyl]phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-3-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-[4-[4-(trifluoromethyl)phenyl]phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-3-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 86699210 |
| Molecular Formula | C27H27F3N2OSSi |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | trimethyl-[2-[[5-[4-[4-(trifluoromethyl)phenyl]phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-3-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)c2c1-c1ccsc1C2 |
| InChI | InChI=1S/C27H27F3N2OSSi/c1-35(2,3)15-13-33-17-32-26-22-12-14-34-24(22)16-23(26)25(31-32)20-6-4-18(5-7-20)19-8-10-21(11-9-19)27(28,29)30/h4-12,14H,13,15-17H2,1-3H3 |
| InChIKey | BXZMONFMXPRGEG-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|