About [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate
[(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate (PubChem CID 86699705) has the molecular formula C17H14F4N2O6S
and a molecular weight of 450.37 g/mol. Its IUPAC name is [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate.
Molecular Properties
| Compound Name | [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate |
| PubChem CID | 86699705 |
| Molecular Formula | C17H14F4N2O6S |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate |
| SMILES | CC(=O)OC[C@](NS(=O)(=O)c1ccccc1[N+](=O)[O-])(c1cccc(F)c1F)C(F)F |
| InChI | InChI=1S/C17H14F4N2O6S/c1-10(24)29-9-17(16(20)21,11-5-4-6-12(18)15(11)19)22-30(27,28)14-8-3-2-7-13(14)23(25)26/h2-8,16,22H,9H2,1H3/t17-/m0/s1 |
| InChIKey | VPJDIKMKLZROCF-KRWDZBQOSA-N |
| XLogP | 2.88 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate?
The IUPAC name of [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate (CID 86699705) is [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate.
What is the SMILES notation for [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate?
The canonical SMILES for [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate is CC(=O)OC[C@](NS(=O)(=O)c1ccccc1[N+](=O)[O-])(c1cccc(F)c1F)C(F)F.
What is the InChIKey of [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate?
The InChIKey is VPJDIKMKLZROCF-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H14F4N2O6S/c1-10(24)29-9-17(16(20)21,11-5-4-6-12(18)15(11)19)22-30(27,28)14-8-3-2-7-13(14)23(25)26/h2-8,16,22H,9H2,1H3/t17-/m0/s1.
What are the key properties of [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate?
[(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate has a molecular weight of 450.37 g/mol, XLogP of 2.88, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-(2,3-difluorophenyl)-3,3-difluoro-2-[(2-nitrophenyl)sulfonylamino]propyl] acetate is sourced from PubChem (CID 86699705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).