About (E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester
(E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester (PubChem CID 86699715) has the molecular formula C9H10F2N2O4
and a molecular weight of 248.18 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl (E)-4-diazo-3-(difluoromethyl)pent-2-enedioate.
Molecular Properties
| Compound Name | (E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester |
| PubChem CID | 86699715 |
| Molecular Formula | C9H10F2N2O4 |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-O-ethyl 1-O-methyl (E)-4-diazo-3-(difluoromethyl)pent-2-enedioate |
| SMILES | CCOC(=O)C(=[N+]=[N-])/C(=C\C(=O)OC)/C(F)F |
| InChI | InChI=1S/C9H10F2N2O4/c1-3-17-9(15)7(13-12)5(8(10)11)4-6(14)16-2/h4,8H,3H2,1-2H3/b5-4+ |
| InChIKey | BFDOHZADSLTIAV-SNAWJCMRSA-N |
| XLogP | 1.50 |
| TPSA | 54.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | 386 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester?
The IUPAC name of (E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester (CID 86699715) is 5-O-ethyl 1-O-methyl (E)-4-diazo-3-(difluoromethyl)pent-2-enedioate.
What is the SMILES notation for (E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester?
The canonical SMILES for (E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester is CCOC(=O)C(=[N+]=[N-])/C(=C\C(=O)OC)/C(F)F.
What is the InChIKey of (E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester?
The InChIKey is BFDOHZADSLTIAV-SNAWJCMRSA-N. The full InChI is InChI=1S/C9H10F2N2O4/c1-3-17-9(15)7(13-12)5(8(10)11)4-6(14)16-2/h4,8H,3H2,1-2H3/b5-4+.
What are the key properties of (E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester?
(E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester has a molecular weight of 248.18 g/mol, XLogP of 1.50, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-Diazo-3-difluoromethyl-pent-2-enedioic acid 5-ethyl ester 1-methyl ester is sourced from PubChem (CID 86699715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).