About 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate
5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate (PubChem CID 86700009) has the molecular formula C18H25NO4
and a molecular weight of 319.40 g/mol. Its IUPAC name is 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate.
Molecular Properties
| Compound Name | 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate |
| PubChem CID | 86700009 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate |
| SMILES | CC(C)[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCCCc1ccccc1 |
| InChI | InChI=1S/C18H25NO4/c1-13(2)16-15(17(20)23-16)19-18(21)22-12-8-4-7-11-14-9-5-3-6-10-14/h3,5-6,9-10,13,15-16H,4,7-8,11-12H2,1-2H3,(H,19,21)/t15-,16+/m1/s1 |
| InChIKey | OFKUGJHNJFEZIC-CVEARBPZSA-N |
| XLogP | 3.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate?
The IUPAC name of 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate (CID 86700009) is 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate.
What is the SMILES notation for 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate?
The canonical SMILES for 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate is CC(C)[C@@H]1OC(=O)[C@@H]1NC(=O)OCCCCCc1ccccc1.
What is the InChIKey of 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate?
The InChIKey is OFKUGJHNJFEZIC-CVEARBPZSA-N. The full InChI is InChI=1S/C18H25NO4/c1-13(2)16-15(17(20)23-16)19-18(21)22-12-8-4-7-11-14-9-5-3-6-10-14/h3,5-6,9-10,13,15-16H,4,7-8,11-12H2,1-2H3,(H,19,21)/t15-,16+/m1/s1.
What are the key properties of 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate?
5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate has a molecular weight of 319.40 g/mol, XLogP of 3.08, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylpentyl N-[(3R,4S)-2-oxo-4-propan-2-yloxetan-3-yl]carbamate is sourced from PubChem (CID 86700009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).