C11H13F4NaO7S — CID 86700528
sodium 2-[2,4-bis(methoxycarbonyl)cyclopentyl]-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 86700528) has the molecular formula C11H13F4NaO7S and a molecular weight of 388.27 g/mol. Its IUPAC name is sodium 2-[2,4-bis(methoxycarbonyl)cyclopentyl]-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | sodium 2-[2,4-bis(methoxycarbonyl)cyclopentyl]-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 86700528 |
| Molecular Formula | C11H13F4NaO7S |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | sodium 2-[2,4-bis(methoxycarbonyl)cyclopentyl]-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | COC(=O)C1CC(C(=O)OC)C(C(F)(F)C(F)(F)S(=O)(=O)[O-])C1.[Na+] |
| InChI | InChI=1S/C11H14F4O7S.Na/c1-21-8(16)5-3-6(9(17)22-2)7(4-5)10(12,13)11(14,15)23(18,19)20;/h5-7H,3-4H2,1-2H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | CKTZWXRIJVIHIU-UHFFFAOYSA-M |
| XLogP | -2.25 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|