C15H16ClF3N4OS — CID 86700574
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(2,2,2-trifluoroethylsulfanyl)propanamide (PubChem CID 86700574) has the molecular formula C15H16ClF3N4OS and a molecular weight of 392.83 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(2,2,2-trifluoroethylsulfanyl)propanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(2,2,2-trifluoroethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 86700574 |
| Molecular Formula | C15H16ClF3N4OS |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(2,2,2-trifluoroethylsulfanyl)propanamide |
| SMILES | CCN(C(=O)CCSCC(F)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C15H16ClF3N4OS/c1-2-22(13(24)5-7-25-10-15(17,18)19)12-9-23(21-14(12)16)11-4-3-6-20-8-11/h3-4,6,8-9H,2,5,7,10H2,1H3 |
| InChIKey | DUHOCWMGSDAAFP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|