C17H19ClF3N5O2S — CID 86700585
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-(ethylcarbamoyl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide (PubChem CID 86700585) has the molecular formula C17H19ClF3N5O2S and a molecular weight of 449.89 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-(ethylcarbamoyl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-(ethylcarbamoyl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide |
|---|---|
| PubChem CID | 86700585 |
| Molecular Formula | C17H19ClF3N5O2S |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-(ethylcarbamoyl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide |
| SMILES | CCNC(=O)N(C(=O)CCSCCC(F)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C17H19ClF3N5O2S/c1-2-23-16(28)26(14(27)5-8-29-9-6-17(19,20)21)13-11-25(24-15(13)18)12-4-3-7-22-10-12/h3-4,7,10-11H,2,5-6,8-9H2,1H3,(H,23,28) |
| InChIKey | DRPRUZBSBWWENX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|