C17H20ClF3N4OS — CID 86700612
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(3,3,3-trifluoro-2-methylpropyl)sulfanylpropanamide (PubChem CID 86700612) has the molecular formula C17H20ClF3N4OS and a molecular weight of 420.89 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(3,3,3-trifluoro-2-methylpropyl)sulfanylpropanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(3,3,3-trifluoro-2-methylpropyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 86700612 |
| Molecular Formula | C17H20ClF3N4OS |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(3,3,3-trifluoro-2-methylpropyl)sulfanylpropanamide |
| SMILES | CCN(C(=O)CCSCC(C)C(F)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C17H20ClF3N4OS/c1-3-24(15(26)6-8-27-11-12(2)17(19,20)21)14-10-25(23-16(14)18)13-5-4-7-22-9-13/h4-5,7,9-10,12H,3,6,8,11H2,1-2H3 |
| InChIKey | CDMXOHDWVLUOQA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|