C16H19ClF3N5O — CID 86700620
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(3,3,3-trifluoropropylamino)propanamide (PubChem CID 86700620) has the molecular formula C16H19ClF3N5O and a molecular weight of 389.81 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(3,3,3-trifluoropropylamino)propanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(3,3,3-trifluoropropylamino)propanamide |
|---|---|
| PubChem CID | 86700620 |
| Molecular Formula | C16H19ClF3N5O |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-3-(3,3,3-trifluoropropylamino)propanamide |
| SMILES | CCN(C(=O)CCNCCC(F)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C16H19ClF3N5O/c1-2-24(14(26)5-8-21-9-6-16(18,19)20)13-11-25(23-15(13)17)12-4-3-7-22-10-12/h3-4,7,10-11,21H,2,5-6,8-9H2,1H3 |
| InChIKey | YSXJZAZKHKQKSW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|