C14H16Cl2N4O2 — CID 86700644
tert-butyl N-[3-chloro-1-(5-chloro-3-pyridinyl)pyrazol-4-yl]-N-methylcarbamate (PubChem CID 86700644) has the molecular formula C14H16Cl2N4O2 and a molecular weight of 343.21 g/mol. Its IUPAC name is tert-butyl N-[3-chloro-1-(5-chloro-3-pyridinyl)pyrazol-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-chloro-1-(5-chloro-3-pyridinyl)pyrazol-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 86700644 |
| Molecular Formula | C14H16Cl2N4O2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | tert-butyl N-[3-chloro-1-(5-chloro-3-pyridinyl)pyrazol-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1cn(-c2cncc(Cl)c2)nc1Cl |
| InChI | InChI=1S/C14H16Cl2N4O2/c1-14(2,3)22-13(21)19(4)11-8-20(18-12(11)16)10-5-9(15)6-17-7-10/h5-8H,1-4H3 |
| InChIKey | WACYBHRTAQFVNE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |