C16H28O5 — CID 86700737
tert-butyl (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxypent-4-enoate (PubChem CID 86700737) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxypent-4-enoate.
| Compound Name | tert-butyl (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxypent-4-enoate |
|---|---|
| PubChem CID | 86700737 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | tert-butyl (2R,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxypent-4-enoate |
| SMILES | C=C[C@H]([C@@H]1CCOC(C)(C)O1)[C@@H](OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28O5/c1-8-11(12-9-10-19-16(5,6)20-12)13(18-7)14(17)21-15(2,3)4/h8,11-13H,1,9-10H2,2-7H3/t11-,12+,13-/m1/s1 |
| InChIKey | XJUZGDDOFLRCDT-FRRDWIJNSA-N |
| XLogP | 2.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|